About ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate
ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate (PubChem CID 102526744) has the molecular formula C18H12FNO2S2
and a molecular weight of 357.43 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate |
| PubChem CID | 102526744 |
| Molecular Formula | C18H12FNO2S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccc3nc(-c4ccc(F)cc4)sc32)s1 |
| InChI | InChI=1S/C18H12FNO2S2/c1-2-22-18(21)15-9-12-14(23-15)8-7-13-16(12)24-17(20-13)10-3-5-11(19)6-4-10/h3-9H,2H2,1H3 |
| InChIKey | ZIVVQGVKIYOBJN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate?
The IUPAC name of ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate (CID 102526744) is ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate.
What is the SMILES notation for ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate?
The canonical SMILES for ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate is CCOC(=O)c1cc2c(ccc3nc(-c4ccc(F)cc4)sc32)s1.
What is the InChIKey of ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate?
The InChIKey is ZIVVQGVKIYOBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FNO2S2/c1-2-22-18(21)15-9-12-14(23-15)8-7-13-16(12)24-17(20-13)10-3-5-11(19)6-4-10/h3-9H,2H2,1H3.
What are the key properties of ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate?
ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate has a molecular weight of 357.43 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-fluorophenyl)thieno[2,3-g][1,3]benzothiazole-7-carboxylate is sourced from PubChem (CID 102526744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).