About ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate
ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate (PubChem CID 102527258) has the molecular formula C30H28N2O4
and a molecular weight of 480.56 g/mol. Its IUPAC name is ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate |
| PubChem CID | 102527258 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(C#Cc2ccncc2)ccc(C#Cc2ccncc2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H28N2O4/c1-29(2,3)35-27(33)25-23(9-7-21-13-17-31-18-14-21)11-12-24(10-8-22-15-19-32-20-16-22)26(25)28(34)36-30(4,5)6/h11-20H,1-6H3 |
| InChIKey | DYZSMZUYYOIGMD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate?
The IUPAC name of ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate (CID 102527258) is ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate is CC(C)(C)OC(=O)c1c(C#Cc2ccncc2)ccc(C#Cc2ccncc2)c1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate?
The InChIKey is DYZSMZUYYOIGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2O4/c1-29(2,3)35-27(33)25-23(9-7-21-13-17-31-18-14-21)11-12-24(10-8-22-15-19-32-20-16-22)26(25)28(34)36-30(4,5)6/h11-20H,1-6H3.
What are the key properties of ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate?
ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate has a molecular weight of 480.56 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 3,6-bis(2-pyridin-4-ylethynyl)benzene-1,2-dicarboxylate is sourced from PubChem (CID 102527258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).