C26H21BrN2O2 — CID 102527474
16-bromo-5-methyl-10-(4-methylphenyl)-2-(nitromethyl)-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3(8),4,6,9,13(18),14,16-octaene (PubChem CID 102527474) has the molecular formula C26H21BrN2O2 and a molecular weight of 473.37 g/mol. Its IUPAC name is 16-bromo-5-methyl-10-(4-methylphenyl)-2-(nitromethyl)-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3(8),4,6,9,13(18),14,16-octaene.
| Compound Name | 16-bromo-5-methyl-10-(4-methylphenyl)-2-(nitromethyl)-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3(8),4,6,9,13(18),14,16-octaene |
|---|---|
| PubChem CID | 102527474 |
| Molecular Formula | C26H21BrN2O2 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 16-bromo-5-methyl-10-(4-methylphenyl)-2-(nitromethyl)-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3(8),4,6,9,13(18),14,16-octaene |
| SMILES | Cc1ccc(C2=Cc3ccc(C)cc3C(C[N+](=O)[O-])c3c2[nH]c2ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C26H21BrN2O2/c1-15-3-6-17(7-4-15)21-12-18-8-5-16(2)11-20(18)23(14-29(30)31)25-22-13-19(27)9-10-24(22)28-26(21)25/h3-13,23,28H,14H2,1-2H3 |
| InChIKey | SLIFZYNBEZUDHW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|