C18H26O7 — CID 102527610
methyl (3aS,5R,7aS)-2-(methoxymethoxy)-7a-methyl-5-(2-methyl-1,3-dioxolan-2-yl)-7-oxo-3a,4,5,6-tetrahydro-3H-indene-1-carboxylate (PubChem CID 102527610) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl (3aS,5R,7aS)-2-(methoxymethoxy)-7a-methyl-5-(2-methyl-1,3-dioxolan-2-yl)-7-oxo-3a,4,5,6-tetrahydro-3H-indene-1-carboxylate.
| Compound Name | methyl (3aS,5R,7aS)-2-(methoxymethoxy)-7a-methyl-5-(2-methyl-1,3-dioxolan-2-yl)-7-oxo-3a,4,5,6-tetrahydro-3H-indene-1-carboxylate |
|---|---|
| PubChem CID | 102527610 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl (3aS,5R,7aS)-2-(methoxymethoxy)-7a-methyl-5-(2-methyl-1,3-dioxolan-2-yl)-7-oxo-3a,4,5,6-tetrahydro-3H-indene-1-carboxylate |
| SMILES | COCOC1=C(C(=O)OC)[C@@]2(C)C(=O)C[C@H](C3(C)OCCO3)C[C@H]2C1 |
| InChI | InChI=1S/C18H26O7/c1-17-11(8-13(23-10-21-3)15(17)16(20)22-4)7-12(9-14(17)19)18(2)24-5-6-25-18/h11-12H,5-10H2,1-4H3/t11-,12+,17+/m0/s1 |
| InChIKey | ZTVUQHZNKKUHQY-XWCIJXRUSA-N |
| XLogP | 1.80 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|