About 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid
4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid (PubChem CID 10252787) has the molecular formula C26H22N2O5
and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid |
| PubChem CID | 10252787 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid |
| SMILES | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2C(=O)O)c1 |
| InChI | InChI=1S/C26H22N2O5/c1-31-20-9-5-6-18(12-20)15-28-25(26(29)30)21(24(27-28)19-7-3-2-4-8-19)13-17-10-11-22-23(14-17)33-16-32-22/h2-12,14H,13,15-16H2,1H3,(H,29,30) |
| InChIKey | FNTQOHODKUIKDA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid?
The IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid (CID 10252787) is 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid.
What is the SMILES notation for 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid?
The canonical SMILES for 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid is COc1cccc(Cn2nc(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2C(=O)O)c1.
What is the InChIKey of 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid?
The InChIKey is FNTQOHODKUIKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O5/c1-31-20-9-5-6-18(12-20)15-28-25(26(29)30)21(24(27-28)19-7-3-2-4-8-19)13-17-10-11-22-23(14-17)33-16-32-22/h2-12,14H,13,15-16H2,1H3,(H,29,30).
What are the key properties of 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid?
4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid has a molecular weight of 442.47 g/mol, XLogP of 4.62, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-ylmethyl)-1-[(3-methoxyphenyl)methyl]-3-phenylpyrazole-5-carboxylic acid is sourced from PubChem (CID 10252787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).