About phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate
phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate (PubChem CID 10252795) has the molecular formula C23H18N6O2S
and a molecular weight of 442.50 g/mol. Its IUPAC name is phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate |
| PubChem CID | 10252795 |
| Molecular Formula | C23H18N6O2S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate |
| SMILES | Cn1cnc(-c2cccc(NC(=O)Oc3ccccc3)c2)c1-c1cc2c(N)ncnc2s1 |
| InChI | InChI=1S/C23H18N6O2S/c1-29-13-27-19(20(29)18-11-17-21(24)25-12-26-22(17)32-18)14-6-5-7-15(10-14)28-23(30)31-16-8-3-2-4-9-16/h2-13H,1H3,(H,28,30)(H2,24,25,26) |
| InChIKey | AVCQDJJODLIYBB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate?
The IUPAC name of phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate (CID 10252795) is phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate.
What is the SMILES notation for phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate?
The canonical SMILES for phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate is Cn1cnc(-c2cccc(NC(=O)Oc3ccccc3)c2)c1-c1cc2c(N)ncnc2s1.
What is the InChIKey of phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate?
The InChIKey is AVCQDJJODLIYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N6O2S/c1-29-13-27-19(20(29)18-11-17-21(24)25-12-26-22(17)32-18)14-6-5-7-15(10-14)28-23(30)31-16-8-3-2-4-9-16/h2-13H,1H3,(H,28,30)(H2,24,25,26).
What are the key properties of phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate?
phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate has a molecular weight of 442.50 g/mol, XLogP of 4.95, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[3-[5-(4-aminothieno[2,3-d]pyrimidin-6-yl)-1-methylimidazol-4-yl]phenyl]carbamate is sourced from PubChem (CID 10252795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).