C46H57BrO5SSi2 — CID 102528225
[(2S,4R,5S)-1-(benzenesulfinyl)-5-bromo-6-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 102528225) has the molecular formula C46H57BrO5SSi2 and a molecular weight of 858.10 g/mol. Its IUPAC name is [(2S,4R,5S)-1-(benzenesulfinyl)-5-bromo-6-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,4R,5S)-1-(benzenesulfinyl)-5-bromo-6-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102528225 |
| Molecular Formula | C46H57BrO5SSi2 |
| Molecular Weight | 858.10 g/mol |
| Exact Mass | 856.26 |
| IUPAC Name | [(2S,4R,5S)-1-(benzenesulfinyl)-5-bromo-6-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | COCO[C@H](C[C@@H](CS(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](Br)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C46H57BrO5SSi2/c1-45(2,3)54(39-25-15-9-16-26-39,40-27-17-10-18-28-40)51-34-43(47)44(50-36-49-7)33-37(35-53(48)38-23-13-8-14-24-38)52-55(46(4,5)6,41-29-19-11-20-30-41)42-31-21-12-22-32-42/h8-32,37,43-44H,33-36H2,1-7H3/t37-,43-,44+,53?/m0/s1 |
| InChIKey | FQAMUOFZIDRLHO-LHJWZXIASA-N |
| XLogP | 8.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.10 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|