C30H39BrO5SSi — CID 102528228
(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)hexan-1-ol (PubChem CID 102528228) has the molecular formula C30H39BrO5SSi and a molecular weight of 619.69 g/mol. Its IUPAC name is (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)hexan-1-ol.
| Compound Name | (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 102528228 |
| Molecular Formula | C30H39BrO5SSi |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)hexan-1-ol |
| SMILES | COCO[C@H](C[C@@H](CS(=O)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](Br)CO |
| InChI | InChI=1S/C30H39BrO5SSi/c1-30(2,3)38(26-16-10-6-11-17-26,27-18-12-7-13-19-27)36-24(20-29(28(31)21-32)35-23-34-4)22-37(33)25-14-8-5-9-15-25/h5-19,24,28-29,32H,20-23H2,1-4H3/t24-,28-,29+,37?/m0/s1 |
| InChIKey | LKYSOFHNGOTHDY-LORXTOJASA-N |
| XLogP | 4.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|