C17H29BO5 — CID 102528904
3-methoxypropyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate (PubChem CID 102528904) has the molecular formula C17H29BO5 and a molecular weight of 324.23 g/mol. Its IUPAC name is 3-methoxypropyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate.
| Compound Name | 3-methoxypropyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102528904 |
| Molecular Formula | C17H29BO5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 3-methoxypropyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate |
| SMILES | COCCCOC(=O)C1=C(B2OC(C)(C)C(C)(C)O2)CCCC1 |
| InChI | InChI=1S/C17H29BO5/c1-16(2)17(3,4)23-18(22-16)14-10-7-6-9-13(14)15(19)21-12-8-11-20-5/h6-12H2,1-5H3 |
| InChIKey | LJROTNVIIQBZBQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|