C23H31NO5 — CID 102529015
tert-butyl (E)-3-[(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]prop-2-enoate (PubChem CID 102529015) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is tert-butyl (E)-3-[(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102529015 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | tert-butyl (E)-3-[(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=CCON(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H31NO5/c1-22(2,3)29-20(25)12-11-18-13-14-27-24(15-17-9-7-6-8-10-17)21(18)19-16-26-23(4,5)28-19/h6-13,19,21H,14-16H2,1-5H3/b12-11+/t19-,21-/m1/s1 |
| InChIKey | OVCHCNHIZMRFPX-FIUOBNDQSA-N |
| XLogP | 3.78 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|