About 1-phenylmethoxy-2,5-dihydropyrrole
1-phenylmethoxy-2,5-dihydropyrrole (PubChem CID 102529031) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-phenylmethoxy-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-phenylmethoxy-2,5-dihydropyrrole |
| PubChem CID | 102529031 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-phenylmethoxy-2,5-dihydropyrrole |
| SMILES | C1=CCN(OCc2ccccc2)C1 |
| InChI | InChI=1S/C11H13NO/c1-2-6-11(7-3-1)10-13-12-8-4-5-9-12/h1-7H,8-10H2 |
| InChIKey | ATQSKDLACPVSLM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylmethoxy-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxy-2,5-dihydropyrrole?
The IUPAC name of 1-phenylmethoxy-2,5-dihydropyrrole (CID 102529031) is 1-phenylmethoxy-2,5-dihydropyrrole.
What is the SMILES notation for 1-phenylmethoxy-2,5-dihydropyrrole?
The canonical SMILES for 1-phenylmethoxy-2,5-dihydropyrrole is C1=CCN(OCc2ccccc2)C1.
What is the InChIKey of 1-phenylmethoxy-2,5-dihydropyrrole?
The InChIKey is ATQSKDLACPVSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-6-11(7-3-1)10-13-12-8-4-5-9-12/h1-7H,8-10H2.
What are the key properties of 1-phenylmethoxy-2,5-dihydropyrrole?
1-phenylmethoxy-2,5-dihydropyrrole has a molecular weight of 175.23 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxy-2,5-dihydropyrrole is sourced from PubChem (CID 102529031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).