C39H41N2O4+ — CID 102529048
methyl 4-[[3-[(4-methoxycarbonylphenyl)methyl]-4,5-bis(4-propan-2-ylphenyl)imidazol-3-ium-1-yl]methyl]benzoate (PubChem CID 102529048) has the molecular formula C39H41N2O4+ and a molecular weight of 601.77 g/mol. Its IUPAC name is methyl 4-[[3-[(4-methoxycarbonylphenyl)methyl]-4,5-bis(4-propan-2-ylphenyl)imidazol-3-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-[(4-methoxycarbonylphenyl)methyl]-4,5-bis(4-propan-2-ylphenyl)imidazol-3-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 102529048 |
| Molecular Formula | C39H41N2O4+ |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | methyl 4-[[3-[(4-methoxycarbonylphenyl)methyl]-4,5-bis(4-propan-2-ylphenyl)imidazol-3-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2c[n+](Cc3ccc(C(=O)OC)cc3)c(-c3ccc(C(C)C)cc3)c2-c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C39H41N2O4/c1-26(2)30-15-19-32(20-16-30)36-37(33-21-17-31(18-22-33)27(3)4)41(24-29-9-13-35(14-10-29)39(43)45-6)25-40(36)23-28-7-11-34(12-8-28)38(42)44-5/h7-22,25-27H,23-24H2,1-6H3/q+1 |
| InChIKey | BLRFCALMASEPAK-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|