C27H21BrN2O2 — CID 102529392
4-(3-bromophenyl)-1,6-dimethyl-2,2-diphenylpyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 102529392) has the molecular formula C27H21BrN2O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-(3-bromophenyl)-1,6-dimethyl-2,2-diphenylpyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 4-(3-bromophenyl)-1,6-dimethyl-2,2-diphenylpyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 102529392 |
| Molecular Formula | C27H21BrN2O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 4-(3-bromophenyl)-1,6-dimethyl-2,2-diphenylpyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CN1C(=O)C2=C(C1=O)N(C)C(c1ccccc1)(c1ccccc1)C=C2c1cccc(Br)c1 |
| InChI | InChI=1S/C27H21BrN2O2/c1-29-25(31)23-22(18-10-9-15-21(28)16-18)17-27(19-11-5-3-6-12-19,20-13-7-4-8-14-20)30(2)24(23)26(29)32/h3-17H,1-2H3 |
| InChIKey | IOMLPPWQJXUCJA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|