About methyl-bis(2,3,5,6-tetramethylphenyl)silanylium
methyl-bis(2,3,5,6-tetramethylphenyl)silanylium (PubChem CID 102529630) has the molecular formula C21H31Si+
and a molecular weight of 311.57 g/mol. Its IUPAC name is methyl-bis(2,3,5,6-tetramethylphenyl)silanylium.
Molecular Properties
| Compound Name | methyl-bis(2,3,5,6-tetramethylphenyl)silanylium |
| PubChem CID | 102529630 |
| Molecular Formula | C21H31Si+ |
| Molecular Weight | 311.57 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | methyl-bis(2,3,5,6-tetramethylphenyl)silanylium |
| SMILES | Cc1cc(C)c(C)c([SiH2+](C)c2c(C)c(C)cc(C)c2C)c1C |
| InChI | InChI=1S/C21H31Si/c1-12-10-13(2)17(6)20(16(12)5)22(9)21-18(7)14(3)11-15(4)19(21)8/h10-11H,22H2,1-9H3/q+1 |
| InChIKey | WMJQWHYVWVHXEZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-bis(2,3,5,6-tetramethylphenyl)silanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-bis(2,3,5,6-tetramethylphenyl)silanylium?
The IUPAC name of methyl-bis(2,3,5,6-tetramethylphenyl)silanylium (CID 102529630) is methyl-bis(2,3,5,6-tetramethylphenyl)silanylium.
What is the SMILES notation for methyl-bis(2,3,5,6-tetramethylphenyl)silanylium?
The canonical SMILES for methyl-bis(2,3,5,6-tetramethylphenyl)silanylium is Cc1cc(C)c(C)c([SiH2+](C)c2c(C)c(C)cc(C)c2C)c1C.
What is the InChIKey of methyl-bis(2,3,5,6-tetramethylphenyl)silanylium?
The InChIKey is WMJQWHYVWVHXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31Si/c1-12-10-13(2)17(6)20(16(12)5)22(9)21-18(7)14(3)11-15(4)19(21)8/h10-11H,22H2,1-9H3/q+1.
What are the key properties of methyl-bis(2,3,5,6-tetramethylphenyl)silanylium?
methyl-bis(2,3,5,6-tetramethylphenyl)silanylium has a molecular weight of 311.57 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-bis(2,3,5,6-tetramethylphenyl)silanylium is sourced from PubChem (CID 102529630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).