C38H22S12 — CID 102529758
2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]cyclopentylidene]-1,3-benzodithiole (PubChem CID 102529758) has the molecular formula C38H22S12 and a molecular weight of 863.40 g/mol. Its IUPAC name is 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]cyclopentylidene]-1,3-benzodithiole.
| Compound Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]cyclopentylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102529758 |
| Molecular Formula | C38H22S12 |
| Molecular Weight | 863.40 g/mol |
| Exact Mass | 861.84 |
| IUPAC Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]cyclopentylidene]-1,3-benzodithiole |
| SMILES | CSC1=C(SC)SC(=C2C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C2=C2Sc3ccccc3S2)S1 |
| InChI | InChI=1S/C38H22S12/c1-39-37-38(40-2)50-36(49-37)31-29(34-45-23-15-7-8-16-24(23)46-34)27(32-41-19-11-3-4-12-20(19)42-32)28(33-43-21-13-5-6-14-22(21)44-33)30(31)35-47-25-17-9-10-18-26(25)48-35/h3-18H,1-2H3 |
| InChIKey | NOBIEGLENQRAKF-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.40 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |