C38H22S10 — CID 102529759
2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-(4,5-dimethyl-1,3-dithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole (PubChem CID 102529759) has the molecular formula C38H22S10 and a molecular weight of 799.26 g/mol. Its IUPAC name is 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-(4,5-dimethyl-1,3-dithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole.
| Compound Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-(4,5-dimethyl-1,3-dithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102529759 |
| Molecular Formula | C38H22S10 |
| Molecular Weight | 799.26 g/mol |
| Exact Mass | 797.89 |
| IUPAC Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)-5-(4,5-dimethyl-1,3-dithiol-2-ylidene)cyclopentylidene]-1,3-benzodithiole |
| SMILES | CC1=C(C)SC(=C2C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C2=C2Sc3ccccc3S2)S1 |
| InChI | InChI=1S/C38H22S10/c1-19-20(2)40-34(39-19)29-30(35-41-21-11-3-4-12-22(21)42-35)32(37-45-25-15-7-8-16-26(25)46-37)33(38-47-27-17-9-10-18-28(27)48-38)31(29)36-43-23-13-5-6-14-24(23)44-36/h3-18H,1-2H3 |
| InChIKey | DFJGMWCNIUTEBA-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.26 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |