C15H18OS — CID 102529815
7-methoxy-7-methyl-6,6a,8,10a-tetrahydrobenzo[c]thiochromene (PubChem CID 102529815) has the molecular formula C15H18OS and a molecular weight of 246.38 g/mol. Its IUPAC name is 7-methoxy-7-methyl-6,6a,8,10a-tetrahydrobenzo[c]thiochromene.
| Compound Name | 7-methoxy-7-methyl-6,6a,8,10a-tetrahydrobenzo[c]thiochromene |
|---|---|
| PubChem CID | 102529815 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 7-methoxy-7-methyl-6,6a,8,10a-tetrahydrobenzo[c]thiochromene |
| SMILES | COC1(C)CC=CC2c3ccccc3SCC21 |
| InChI | InChI=1S/C15H18OS/c1-15(16-2)9-5-7-11-12-6-3-4-8-14(12)17-10-13(11)15/h3-8,11,13H,9-10H2,1-2H3 |
| InChIKey | MZSJLDVCVQLMQR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|