C54H76O16 — CID 102529965
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[1,2,2-tris[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzene (PubChem CID 102529965) has the molecular formula C54H76O16 and a molecular weight of 981.19 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[1,2,2-tris[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzene.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[1,2,2-tris[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 102529965 |
| Molecular Formula | C54H76O16 |
| Molecular Weight | 981.19 g/mol |
| Exact Mass | 980.51 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-[1,2,2-tris[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzene |
| SMILES | COCCOCCOCCOc1ccc(C(=C(c2ccc(OCCOCCOCCOC)cc2)c2ccc(OCCOCCOCCOC)cc2)c2ccc(OCCOCCOCCOC)cc2)cc1 |
| InChI | InChI=1S/C54H76O16/c1-55-21-25-59-29-33-63-37-41-67-49-13-5-45(6-14-49)53(46-7-15-50(16-8-46)68-42-38-64-34-30-60-26-22-56-2)54(47-9-17-51(18-10-47)69-43-39-65-35-31-61-27-23-57-3)48-11-19-52(20-12-48)70-44-40-66-36-32-62-28-24-58-4/h5-20H,21-44H2,1-4H3 |
| InChIKey | KLQYAGUTEGAOTO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.19 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|