C25H42O4 — CID 102530326
(2S)-6-[(2S,3S,5R)-5-[(4R,8R)-8-hydroxy-4-methyl-6-methylideneundec-2-ynyl]-3-methyloxolan-2-yl]-2-methylhexanoic acid (PubChem CID 102530326) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (2S)-6-[(2S,3S,5R)-5-[(4R,8R)-8-hydroxy-4-methyl-6-methylideneundec-2-ynyl]-3-methyloxolan-2-yl]-2-methylhexanoic acid.
| Compound Name | (2S)-6-[(2S,3S,5R)-5-[(4R,8R)-8-hydroxy-4-methyl-6-methylideneundec-2-ynyl]-3-methyloxolan-2-yl]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 102530326 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (2S)-6-[(2S,3S,5R)-5-[(4R,8R)-8-hydroxy-4-methyl-6-methylideneundec-2-ynyl]-3-methyloxolan-2-yl]-2-methylhexanoic acid |
| SMILES | C=C(C[C@H](O)CCC)C[C@@H](C)C#CC[C@H]1C[C@H](C)[C@H](CCCC[C@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C25H42O4/c1-6-10-22(26)16-19(3)15-18(2)11-9-13-23-17-21(5)24(29-23)14-8-7-12-20(4)25(27)28/h18,20-24,26H,3,6-8,10,12-17H2,1-2,4-5H3,(H,27,28)/t18-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | PHPCVRAWHMJCKT-CLJXQSCZSA-N |
| XLogP | 5.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|