About (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine
(6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine (PubChem CID 102530618) has the molecular formula C23H16F3NO
and a molecular weight of 379.38 g/mol. Its IUPAC name is (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine.
Molecular Properties
| Compound Name | (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine |
| PubChem CID | 102530618 |
| Molecular Formula | C23H16F3NO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine |
| SMILES | FC(F)(F)[C@]1(c2ccccc2)OC2c3ccccc3C=CN2c2ccccc21 |
| InChI | InChI=1S/C23H16F3NO/c24-23(25,26)22(17-9-2-1-3-10-17)19-12-6-7-13-20(19)27-15-14-16-8-4-5-11-18(16)21(27)28-22/h1-15,21H/t21?,22-/m1/s1 |
| InChIKey | UOFATDUNMCOCLC-FOIFJWKZSA-N |
| XLogP | 6.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine?
The IUPAC name of (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine (CID 102530618) is (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine.
What is the SMILES notation for (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine?
The canonical SMILES for (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine is FC(F)(F)[C@]1(c2ccccc2)OC2c3ccccc3C=CN2c2ccccc21.
What is the InChIKey of (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine?
The InChIKey is UOFATDUNMCOCLC-FOIFJWKZSA-N. The full InChI is InChI=1S/C23H16F3NO/c24-23(25,26)22(17-9-2-1-3-10-17)19-12-6-7-13-20(19)27-15-14-16-8-4-5-11-18(16)21(27)28-22/h1-15,21H/t21?,22-/m1/s1.
What are the key properties of (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine?
(6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine has a molecular weight of 379.38 g/mol, XLogP of 6.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-phenyl-6-(trifluoromethyl)-4bH-isoquinolino[2,1-a][3,1]benzoxazine is sourced from PubChem (CID 102530618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).