About [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate
[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate (PubChem CID 102531757) has the molecular formula C13H27NO3Si
and a molecular weight of 273.45 g/mol. Its IUPAC name is [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate.
Molecular Properties
| Compound Name | [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate |
| PubChem CID | 102531757 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate |
| SMILES | CC(/C=C/[C@H](C)OC(N)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27NO3Si/c1-10(16-12(14)15)8-9-11(2)17-18(6,7)13(3,4)5/h8-11H,1-7H3,(H2,14,15)/b9-8+/t10-,11?/m0/s1 |
| InChIKey | QDHGIWDBWVLRAQ-GQUHTFLRSA-N |
| XLogP | 3.44 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate?
The IUPAC name of [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate (CID 102531757) is [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate.
What is the SMILES notation for [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate?
The canonical SMILES for [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate is CC(/C=C/[C@H](C)OC(N)=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate?
The InChIKey is QDHGIWDBWVLRAQ-GQUHTFLRSA-N. The full InChI is InChI=1S/C13H27NO3Si/c1-10(16-12(14)15)8-9-11(2)17-18(6,7)13(3,4)5/h8-11H,1-7H3,(H2,14,15)/b9-8+/t10-,11?/m0/s1.
What are the key properties of [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate?
[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate has a molecular weight of 273.45 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-5-[tert-butyl(dimethyl)silyl]oxyhex-3-en-2-yl] carbamate is sourced from PubChem (CID 102531757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).