C15H21NO5 — CID 102531848
5-[(2Z,4E)-5-(diethylamino)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 102531848) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 5-[(2Z,4E)-5-(diethylamino)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-5-(diethylamino)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102531848 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-[(2Z,4E)-5-(diethylamino)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCN(/C=C/C=C(\O)C=C1C(=O)OC(C)(C)OC1=O)CC |
| InChI | InChI=1S/C15H21NO5/c1-5-16(6-2)9-7-8-11(17)10-12-13(18)20-15(3,4)21-14(12)19/h7-10,17H,5-6H2,1-4H3/b9-7+,11-8- |
| InChIKey | PVJSCEGNYIMYRA-BGZVTZOUSA-N |
| XLogP | 2.05 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|