About dipropyl 4-bromopyridine-2,6-dicarboxylate
dipropyl 4-bromopyridine-2,6-dicarboxylate (PubChem CID 102532090) has the molecular formula C13H16BrNO4
and a molecular weight of 330.18 g/mol. Its IUPAC name is dipropyl 4-bromopyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | dipropyl 4-bromopyridine-2,6-dicarboxylate |
| PubChem CID | 102532090 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | dipropyl 4-bromopyridine-2,6-dicarboxylate |
| SMILES | CCCOC(=O)c1cc(Br)cc(C(=O)OCCC)n1 |
| InChI | InChI=1S/C13H16BrNO4/c1-3-5-18-12(16)10-7-9(14)8-11(15-10)13(17)19-6-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | BJMWGDZZJMSFDB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipropyl 4-bromopyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl 4-bromopyridine-2,6-dicarboxylate?
The IUPAC name of dipropyl 4-bromopyridine-2,6-dicarboxylate (CID 102532090) is dipropyl 4-bromopyridine-2,6-dicarboxylate.
What is the SMILES notation for dipropyl 4-bromopyridine-2,6-dicarboxylate?
The canonical SMILES for dipropyl 4-bromopyridine-2,6-dicarboxylate is CCCOC(=O)c1cc(Br)cc(C(=O)OCCC)n1.
What is the InChIKey of dipropyl 4-bromopyridine-2,6-dicarboxylate?
The InChIKey is BJMWGDZZJMSFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO4/c1-3-5-18-12(16)10-7-9(14)8-11(15-10)13(17)19-6-4-2/h7-8H,3-6H2,1-2H3.
What are the key properties of dipropyl 4-bromopyridine-2,6-dicarboxylate?
dipropyl 4-bromopyridine-2,6-dicarboxylate has a molecular weight of 330.18 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl 4-bromopyridine-2,6-dicarboxylate is sourced from PubChem (CID 102532090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).