C10H19NO — CID 102532691
(2S,4aR,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 102532691) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,4aR,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | (2S,4aR,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 102532691 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,4aR,8aR)-2,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | C[C@@H]1O[C@@H]2CCCC[C@@H]2CN1C |
| InChI | InChI=1S/C10H19NO/c1-8-11(2)7-9-5-3-4-6-10(9)12-8/h8-10H,3-7H2,1-2H3/t8-,9+,10+/m0/s1 |
| InChIKey | IGHHGSLBUIMYCR-IVZWLZJFSA-N |
| XLogP | 1.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |