C20H24O2Si — CID 102532959
6-trimethylsilyloxytricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde (PubChem CID 102532959) has the molecular formula C20H24O2Si and a molecular weight of 324.50 g/mol. Its IUPAC name is 6-trimethylsilyloxytricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde.
| Compound Name | 6-trimethylsilyloxytricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde |
|---|---|
| PubChem CID | 102532959 |
| Molecular Formula | C20H24O2Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 6-trimethylsilyloxytricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carbaldehyde |
| SMILES | C[Si](C)(C)Oc1c2ccc(c1C=O)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C20H24O2Si/c1-23(2,3)22-20-18-11-9-16-6-4-15(5-7-16)8-10-17(12-13-18)19(20)14-21/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | NYAPVBCICWLACE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|