C26H41N7 — CID 10253296
N-[[4-[[bis(1H-imidazol-2-ylmethyl)amino]methyl]phenyl]methyl]-N',N'-dipropylbutane-1,4-diamine (PubChem CID 10253296) has the molecular formula C26H41N7 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-[[4-[[bis(1H-imidazol-2-ylmethyl)amino]methyl]phenyl]methyl]-N',N'-dipropylbutane-1,4-diamine.
| Compound Name | N-[[4-[[bis(1H-imidazol-2-ylmethyl)amino]methyl]phenyl]methyl]-N',N'-dipropylbutane-1,4-diamine |
|---|---|
| PubChem CID | 10253296 |
| Molecular Formula | C26H41N7 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.34 |
| IUPAC Name | N-[[4-[[bis(1H-imidazol-2-ylmethyl)amino]methyl]phenyl]methyl]-N',N'-dipropylbutane-1,4-diamine |
| SMILES | CCCN(CCC)CCCCNCc1ccc(CN(Cc2ncc[nH]2)Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C26H41N7/c1-3-16-32(17-4-2)18-6-5-11-27-19-23-7-9-24(10-8-23)20-33(21-25-28-12-13-29-25)22-26-30-14-15-31-26/h7-10,12-15,27H,3-6,11,16-22H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | VNHJKTRLVWVBOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|