About 6-(cyclopenten-1-yl)-2,3-dimethylphenol
6-(cyclopenten-1-yl)-2,3-dimethylphenol (PubChem CID 102534081) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-(cyclopenten-1-yl)-2,3-dimethylphenol.
Molecular Properties
| Compound Name | 6-(cyclopenten-1-yl)-2,3-dimethylphenol |
| PubChem CID | 102534081 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 6-(cyclopenten-1-yl)-2,3-dimethylphenol |
| SMILES | Cc1ccc(C2=CCCC2)c(O)c1C |
| InChI | InChI=1S/C13H16O/c1-9-7-8-12(13(14)10(9)2)11-5-3-4-6-11/h5,7-8,14H,3-4,6H2,1-2H3 |
| InChIKey | DROIHCRMDHLNQC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(cyclopenten-1-yl)-2,3-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclopenten-1-yl)-2,3-dimethylphenol?
The IUPAC name of 6-(cyclopenten-1-yl)-2,3-dimethylphenol (CID 102534081) is 6-(cyclopenten-1-yl)-2,3-dimethylphenol.
What is the SMILES notation for 6-(cyclopenten-1-yl)-2,3-dimethylphenol?
The canonical SMILES for 6-(cyclopenten-1-yl)-2,3-dimethylphenol is Cc1ccc(C2=CCCC2)c(O)c1C.
What is the InChIKey of 6-(cyclopenten-1-yl)-2,3-dimethylphenol?
The InChIKey is DROIHCRMDHLNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-9-7-8-12(13(14)10(9)2)11-5-3-4-6-11/h5,7-8,14H,3-4,6H2,1-2H3.
What are the key properties of 6-(cyclopenten-1-yl)-2,3-dimethylphenol?
6-(cyclopenten-1-yl)-2,3-dimethylphenol has a molecular weight of 188.27 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclopenten-1-yl)-2,3-dimethylphenol is sourced from PubChem (CID 102534081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).