3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid

C15H12N2O3 — CID 102534295

IUPAC3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid
SMILESCCc1noc2nc(-c3ccccc3)cc(C(=O)O)c12
InChIInChI=1S/C15H12N2O3/c1-2-11-13-10(15(18)19)8-12(16-14(13)20-17-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,18,19)
InChIKeyAQTVRXASABZCPO-UHFFFAOYSA-N
MW268.27 g/mol
LogP3.15
Rot. Bonds3

About 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid

3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (PubChem CID 102534295) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid
PubChem CID102534295
Molecular FormulaC15H12N2O3
Molecular Weight268.27 g/mol
Exact Mass268.08
IUPAC Name3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid
SMILESCCc1noc2nc(-c3ccccc3)cc(C(=O)O)c12
InChIInChI=1S/C15H12N2O3/c1-2-11-13-10(15(18)19)8-12(16-14(13)20-17-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,18,19)
InChIKeyAQTVRXASABZCPO-UHFFFAOYSA-N
XLogP3.15
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The IUPAC name of 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CID 102534295) is 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The canonical SMILES for 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid is CCc1noc2nc(-c3ccccc3)cc(C(=O)O)c12.
What is the InChIKey of 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
The InChIKey is AQTVRXASABZCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c1-2-11-13-10(15(18)19)8-12(16-14(13)20-17-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,18,19).
What are the key properties of 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid?
3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid has a molecular weight of 268.27 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-phenyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid is sourced from PubChem (CID 102534295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).