C21H16F4N8 — CID 10253530
4-[1-(7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-3-(4-fluorophenyl)pyrazol-4-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 10253530) has the molecular formula C21H16F4N8 and a molecular weight of 456.41 g/mol. Its IUPAC name is 4-[1-(7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-3-(4-fluorophenyl)pyrazol-4-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 4-[1-(7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-3-(4-fluorophenyl)pyrazol-4-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 10253530 |
| Molecular Formula | C21H16F4N8 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-[1-(7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-3-(4-fluorophenyl)pyrazol-4-yl]-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | Fc1ccc(-c2nn(C3=Nn4cnnc4CC3)cc2-c2ccnc(NCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H16F4N8/c22-15-3-1-13(2-4-15)20-16(14-7-8-26-17(9-14)27-11-21(23,24)25)10-32(31-20)19-6-5-18-29-28-12-33(18)30-19/h1-4,7-10,12H,5-6,11H2,(H,26,27) |
| InChIKey | BSHVPNSGTIXLFK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |