C20H24O10S — CID 10253537
tetramethyl (Z)-3-(benzenesulfonyl)hex-3-ene-1,1,6,6-tetracarboxylate (PubChem CID 10253537) has the molecular formula C20H24O10S and a molecular weight of 456.47 g/mol. Its IUPAC name is tetramethyl (Z)-3-(benzenesulfonyl)hex-3-ene-1,1,6,6-tetracarboxylate.
| Compound Name | tetramethyl (Z)-3-(benzenesulfonyl)hex-3-ene-1,1,6,6-tetracarboxylate |
|---|---|
| PubChem CID | 10253537 |
| Molecular Formula | C20H24O10S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | tetramethyl (Z)-3-(benzenesulfonyl)hex-3-ene-1,1,6,6-tetracarboxylate |
| SMILES | COC(=O)C(C/C=C(/CC(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H24O10S/c1-27-17(21)15(18(22)28-2)11-10-14(12-16(19(23)29-3)20(24)30-4)31(25,26)13-8-6-5-7-9-13/h5-10,15-16H,11-12H2,1-4H3/b14-10- |
| InChIKey | WTSHOMCPKIXFTN-UVTDQMKNSA-N |
| XLogP | 1.05 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|