C14H21NO5 — CID 102535747
2-[2-[(1-hydroxybutan-2-ylamino)methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 102535747) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[2-[(1-hydroxybutan-2-ylamino)methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(1-hydroxybutan-2-ylamino)methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 102535747 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[2-[(1-hydroxybutan-2-ylamino)methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | CCC(CO)NCc1cccc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C14H21NO5/c1-3-11(8-16)15-7-10-5-4-6-12(19-2)14(10)20-9-13(17)18/h4-6,11,15-16H,3,7-9H2,1-2H3,(H,17,18) |
| InChIKey | QRPVJULHEWCYSP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |