C20H23NO7 — CID 102536824
[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-2-yloxyoxan-4-yl] acetate (PubChem CID 102536824) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-2-yloxyoxan-4-yl] acetate.
| Compound Name | [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-2-yloxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 102536824 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-naphthalen-2-yloxyoxan-4-yl] acetate |
| SMILES | CC(=O)NC1C(Oc2ccc3ccccc3c2)OC(CO)C(O)C1OC(C)=O |
| InChI | InChI=1S/C20H23NO7/c1-11(23)21-17-19(26-12(2)24)18(25)16(10-22)28-20(17)27-15-8-7-13-5-3-4-6-14(13)9-15/h3-9,16-20,22,25H,10H2,1-2H3,(H,21,23) |
| InChIKey | FRTSLPFLUVGQPA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |