C17H27N3O5S — CID 102536829
4-(2-methylpropyl)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 102536829) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylpropyl)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102536829 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-(2-methylpropyl)-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1c(C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)n[nH]c1=S |
| InChI | InChI=1S/C17H27N3O5S/c1-8(2)7-20-13(18-19-15(20)26)11-9-10(23-16(3,4)22-9)12-14(21-11)25-17(5,6)24-12/h8-12,14H,7H2,1-6H3,(H,19,26) |
| InChIKey | HWZDPXXUALRPHV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|