C17H18N4O2 — CID 102537319
3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 102537319) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 102537319 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]methyl]-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | Cc1noc(CNCc2cc3cccc4c3n(c2=O)CCC4)n1 |
| InChI | InChI=1S/C17H18N4O2/c1-11-19-15(23-20-11)10-18-9-14-8-13-5-2-4-12-6-3-7-21(16(12)13)17(14)22/h2,4-5,8,18H,3,6-7,9-10H2,1H3 |
| InChIKey | STMLPGYKXLIWER-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |