C16H17BrN2 — CID 102539234
5-(1-benzylpyrrolidin-2-yl)-2-bromopyridine (PubChem CID 102539234) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 5-(1-benzylpyrrolidin-2-yl)-2-bromopyridine.
| Compound Name | 5-(1-benzylpyrrolidin-2-yl)-2-bromopyridine |
|---|---|
| PubChem CID | 102539234 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-(1-benzylpyrrolidin-2-yl)-2-bromopyridine |
| SMILES | Brc1ccc(C2CCCN2Cc2ccccc2)cn1 |
| InChI | InChI=1S/C16H17BrN2/c17-16-9-8-14(11-18-16)15-7-4-10-19(15)12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15H,4,7,10,12H2 |
| InChIKey | JUPLTAIGZMZQGA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|