C23H30O8S — CID 10253977
dimethyl 2-[(E)-4-acetyloxy-3-methylbut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate (PubChem CID 10253977) has the molecular formula C23H30O8S and a molecular weight of 466.55 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-acetyloxy-3-methylbut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-4-acetyloxy-3-methylbut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10253977 |
| Molecular Formula | C23H30O8S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | dimethyl 2-[(E)-4-acetyloxy-3-methylbut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate |
| SMILES | C=CC(CC(C/C=C(\C)COC(C)=O)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30O8S/c1-7-19(32(27,28)20-10-8-16(2)9-11-20)14-23(21(25)29-5,22(26)30-6)13-12-17(3)15-31-18(4)24/h7-12,19H,1,13-15H2,2-6H3/b17-12+ |
| InChIKey | QGXPZHIZEOZTDP-SFQUDFHCSA-N |
| XLogP | 2.95 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|