C25H27FN4O2S — CID 10253984
N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-N-methyl-1,2-benzothiazole-3-carboxamide (PubChem CID 10253984) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-N-methyl-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-N-methyl-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 10253984 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-N-methyl-1,2-benzothiazole-3-carboxamide |
| SMILES | CN(CCCCN1CCC(c2noc3cc(F)ccc23)CC1)C(=O)c1nsc2ccccc12 |
| InChI | InChI=1S/C25H27FN4O2S/c1-29(25(31)24-20-6-2-3-7-22(20)33-28-24)12-4-5-13-30-14-10-17(11-15-30)23-19-9-8-18(26)16-21(19)32-27-23/h2-3,6-9,16-17H,4-5,10-15H2,1H3 |
| InChIKey | RRJGHQGFXIURME-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|