C28H38N2O4 — CID 10253991
[(1S,2S,4R,8R,9S,10Z,12R)-12-methoxy-1,5,11-trimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 10253991) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is [(1S,2S,4R,8R,9S,10Z,12R)-12-methoxy-1,5,11-trimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | [(1S,2S,4R,8R,9S,10Z,12R)-12-methoxy-1,5,11-trimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10253991 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | [(1S,2S,4R,8R,9S,10Z,12R)-12-methoxy-1,5,11-trimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CO[C@]12C=C[C@](C)(O1)[C@@H](OC(=O)/C=C/c1cn(C)cn1)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1/C=C\2C |
| InChI | InChI=1S/C28H38N2O4/c1-18(2)22-10-8-19(3)23-15-25(33-26(31)11-9-21-16-30(6)17-29-21)27(5)12-13-28(32-7,34-27)20(4)14-24(22)23/h8-9,11-14,16-18,22-25H,10,15H2,1-7H3/b11-9+,20-14-/t22-,23+,24-,25+,27+,28-/m1/s1 |
| InChIKey | ZYPMSUOVHPJQDD-ALOGICOVSA-N |
| XLogP | 5.24 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|