C20H31N3O3 — CID 102540471
tert-butyl N-[5-[6-(cyclopentylamino)-3-pyridinyl]-5-oxopentyl]carbamate (PubChem CID 102540471) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl N-[5-[6-(cyclopentylamino)-3-pyridinyl]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[6-(cyclopentylamino)-3-pyridinyl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 102540471 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl N-[5-[6-(cyclopentylamino)-3-pyridinyl]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)c1ccc(NC2CCCC2)nc1 |
| InChI | InChI=1S/C20H31N3O3/c1-20(2,3)26-19(25)21-13-7-6-10-17(24)15-11-12-18(22-14-15)23-16-8-4-5-9-16/h11-12,14,16H,4-10,13H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | PMAKWWXOHFVGKR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|