C19H31N3 — CID 102540493
N-cyclohexyl-3-(1-propan-2-ylpiperidin-2-yl)pyridin-2-amine (PubChem CID 102540493) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-cyclohexyl-3-(1-propan-2-ylpiperidin-2-yl)pyridin-2-amine.
| Compound Name | N-cyclohexyl-3-(1-propan-2-ylpiperidin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102540493 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | N-cyclohexyl-3-(1-propan-2-ylpiperidin-2-yl)pyridin-2-amine |
| SMILES | CC(C)N1CCCCC1c1cccnc1NC1CCCCC1 |
| InChI | InChI=1S/C19H31N3/c1-15(2)22-14-7-6-12-18(22)17-11-8-13-20-19(17)21-16-9-4-3-5-10-16/h8,11,13,15-16,18H,3-7,9-10,12,14H2,1-2H3,(H,20,21) |
| InChIKey | ZFSGQXISUNWJMY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |