C23H27N3O2S — CID 102541906
2-(2,5-dimethylpyrrol-1-yl)-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]pyridine (PubChem CID 102541906) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]pyridine.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 102541906 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2c2ccc(-n3c(C)ccc3C)nc2)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-17-7-12-21(13-8-17)29(27,28)25-15-5-4-6-22(25)20-11-14-23(24-16-20)26-18(2)9-10-19(26)3/h7-14,16,22H,4-6,15H2,1-3H3 |
| InChIKey | AKIGENMDFOHAPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|