C17H18N2OS — CID 102541984
[2-(2-methylsulfanyl-3-pyridinyl)pyrrolidin-1-yl]-phenylmethanone (PubChem CID 102541984) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is [2-(2-methylsulfanyl-3-pyridinyl)pyrrolidin-1-yl]-phenylmethanone.
| Compound Name | [2-(2-methylsulfanyl-3-pyridinyl)pyrrolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102541984 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-(2-methylsulfanyl-3-pyridinyl)pyrrolidin-1-yl]-phenylmethanone |
| SMILES | CSc1ncccc1C1CCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2OS/c1-21-16-14(9-5-11-18-16)15-10-6-12-19(15)17(20)13-7-3-2-4-8-13/h2-5,7-9,11,15H,6,10,12H2,1H3 |
| InChIKey | QDSSKEFKDWPJOB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |