C19H24N2S — CID 102542292
3-(1-benzylpyrrolidin-2-yl)-2-propan-2-ylsulfanylpyridine (PubChem CID 102542292) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-(1-benzylpyrrolidin-2-yl)-2-propan-2-ylsulfanylpyridine.
| Compound Name | 3-(1-benzylpyrrolidin-2-yl)-2-propan-2-ylsulfanylpyridine |
|---|---|
| PubChem CID | 102542292 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-(1-benzylpyrrolidin-2-yl)-2-propan-2-ylsulfanylpyridine |
| SMILES | CC(C)Sc1ncccc1C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2S/c1-15(2)22-19-17(10-6-12-20-19)18-11-7-13-21(18)14-16-8-4-3-5-9-16/h3-6,8-10,12,15,18H,7,11,13-14H2,1-2H3 |
| InChIKey | HIGPNYLXXJDMCG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |