C18H22N2O2S2 — CID 102542750
6-methyl-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1H-pyridine-2-thione (PubChem CID 102542750) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 6-methyl-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1H-pyridine-2-thione.
| Compound Name | 6-methyl-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 102542750 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 6-methyl-5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1H-pyridine-2-thione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2c2ccc(=S)[nH]c2C)cc1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-13-6-8-15(9-7-13)24(21,22)20-12-4-3-5-17(20)16-10-11-18(23)19-14(16)2/h6-11,17H,3-5,12H2,1-2H3,(H,19,23) |
| InChIKey | MNOIHRLKUWKXRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|