About 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine
3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine (PubChem CID 10254297) has the molecular formula C24H25Cl2N3O3
and a molecular weight of 474.39 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine |
| PubChem CID | 10254297 |
| Molecular Formula | C24H25Cl2N3O3 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(OCCN3CCOCC3)cc2)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H25Cl2N3O3/c25-21-2-1-3-22(26)20(21)16-32-23-14-18(15-28-24(23)27)17-4-6-19(7-5-17)31-13-10-29-8-11-30-12-9-29/h1-7,14-15H,8-13,16H2,(H2,27,28) |
| InChIKey | SWSODYAMDICARQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine?
The IUPAC name of 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine (CID 10254297) is 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine is Nc1ncc(-c2ccc(OCCN3CCOCC3)cc2)cc1OCc1c(Cl)cccc1Cl.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine?
The InChIKey is SWSODYAMDICARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25Cl2N3O3/c25-21-2-1-3-22(26)20(21)16-32-23-14-18(15-28-24(23)27)17-4-6-19(7-5-17)31-13-10-29-8-11-30-12-9-29/h1-7,14-15H,8-13,16H2,(H2,27,28).
What are the key properties of 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine?
3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine has a molecular weight of 474.39 g/mol, XLogP of 4.93, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine is sourced from PubChem (CID 10254297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).