C26H34O8 — CID 10254309
[(3aS,4S,6E,8S,10E,12S,14E,15aS)-4,12-diacetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate (PubChem CID 10254309) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(3aS,4S,6E,8S,10E,12S,14E,15aS)-4,12-diacetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate.
| Compound Name | [(3aS,4S,6E,8S,10E,12S,14E,15aS)-4,12-diacetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate |
|---|---|
| PubChem CID | 10254309 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(3aS,4S,6E,8S,10E,12S,14E,15aS)-4,12-diacetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)C[C@H](OC(C)=O)/C=C(\C)C[C@H](OC(C)=O)/C=C(\C)C[C@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C26H34O8/c1-14-8-21(31-18(5)27)10-15(2)12-23(33-20(7)29)25-17(4)26(30)34-24(25)13-16(3)11-22(9-14)32-19(6)28/h9-10,13,21-25H,4,8,11-12H2,1-3,5-7H3/b14-9+,15-10+,16-13+/t21-,22+,23-,24-,25-/m0/s1 |
| InChIKey | AEECRLMJHMQCTF-YQIRRFBKSA-N |
| XLogP | 3.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|