C32H26O4 — CID 10254313
[(1R,2S,3R,4S)-2,3-dibenzoyl-4-hydroxy-4-phenylcyclopentyl]-phenylmethanone (PubChem CID 10254313) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-2,3-dibenzoyl-4-hydroxy-4-phenylcyclopentyl]-phenylmethanone.
| Compound Name | [(1R,2S,3R,4S)-2,3-dibenzoyl-4-hydroxy-4-phenylcyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 10254313 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [(1R,2S,3R,4S)-2,3-dibenzoyl-4-hydroxy-4-phenylcyclopentyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](C(=O)c2ccccc2)[C@](O)(c2ccccc2)C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26O4/c33-29(22-13-5-1-6-14-22)26-21-32(36,25-19-11-4-12-20-25)28(31(35)24-17-9-3-10-18-24)27(26)30(34)23-15-7-2-8-16-23/h1-20,26-28,36H,21H2/t26-,27+,28+,32-/m1/s1 |
| InChIKey | MFGHUWSWDMXWSY-QODLHPCFSA-N |
| XLogP | 5.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |