About 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine
2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine (PubChem CID 102543541) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine |
| PubChem CID | 102543541 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine |
| SMILES | COC(C)c1c(C)nn(CCN)c1C |
| InChI | InChI=1S/C10H19N3O/c1-7-10(9(3)14-4)8(2)13(12-7)6-5-11/h9H,5-6,11H2,1-4H3 |
| InChIKey | VFTFHNZEWRVKEU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine?
The IUPAC name of 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine (CID 102543541) is 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine.
What is the SMILES notation for 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine?
The canonical SMILES for 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine is COC(C)c1c(C)nn(CCN)c1C.
What is the InChIKey of 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine?
The InChIKey is VFTFHNZEWRVKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-7-10(9(3)14-4)8(2)13(12-7)6-5-11/h9H,5-6,11H2,1-4H3.
What are the key properties of 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine?
2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine has a molecular weight of 197.28 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-methoxyethyl)-3,5-dimethylpyrazol-1-yl]ethanamine is sourced from PubChem (CID 102543541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).