C23H44N2O6S — CID 10254420
(2S,4R)-1-[(2R)-2-hydroxypropyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide (PubChem CID 10254420) has the molecular formula C23H44N2O6S and a molecular weight of 476.68 g/mol. Its IUPAC name is (2S,4R)-1-[(2R)-2-hydroxypropyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2R)-2-hydroxypropyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10254420 |
| Molecular Formula | C23H44N2O6S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | (2S,4R)-1-[(2R)-2-hydroxypropyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-pentylpyrrolidine-2-carboxamide |
| SMILES | CCCCC[C@@H]1C[C@@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)N(C[C@@H](C)O)C1 |
| InChI | InChI=1S/C23H44N2O6S/c1-6-7-8-9-15-10-16(25(12-15)11-14(4)26)22(30)24-17(13(2)3)21-19(28)18(27)20(29)23(31-21)32-5/h13-21,23,26-29H,6-12H2,1-5H3,(H,24,30)/t14-,15-,16+,17-,18+,19-,20-,21-,23-/m1/s1 |
| InChIKey | QSEHNWXYIRRWPT-UGASLYAWSA-N |
| XLogP | 0.95 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|