C11H14N2 — CID 102544229
2-methyl-4-(2,3,4,5-tetrahydropyridin-6-yl)pyridine (PubChem CID 102544229) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-methyl-4-(2,3,4,5-tetrahydropyridin-6-yl)pyridine.
| Compound Name | 2-methyl-4-(2,3,4,5-tetrahydropyridin-6-yl)pyridine |
|---|---|
| PubChem CID | 102544229 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-methyl-4-(2,3,4,5-tetrahydropyridin-6-yl)pyridine |
| SMILES | Cc1cc(C2=NCCCC2)ccn1 |
| InChI | InChI=1S/C11H14N2/c1-9-8-10(5-7-12-9)11-4-2-3-6-13-11/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | YJNUKQIEXNLQPF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |